| Name | Diethyl sulfite |
| Synonyms | tl158 TL 158 NSC 8838 (C2H5O)2SO BRN 1701906 Ethyl sulfite Diethyl sulfite Diethyl sulphite Ethylethylsulfonate Ethyl sulfite, (Et2SO3) SULFUROUS ACID DIETHYL ESTER Sulfurous acid, diethyl ester Sulphurous acid diethyl ester Diethyl ester of sulfurous acid 4-01-00-01324 (Beilstein Handbook Reference) |
| CAS | 623-81-4 |
| EINECS | 210-815-5 |
| InChI | InChI=1/C4H10O3S/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3 |
| Molecular Formula | C4H10O3S |
| Molar Mass | 138.19 |
| Density | 1.077g/mLat 25°C(lit.) |
| Boling Point | 158-160°C(lit.) |
| Flash Point | 129°F |
| Vapor Presure | 3.71mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless |
| BRN | 1701906 |
| Storage Condition | Flammables area |
| Refractive Index | n20/D 1.414(lit.) |
| MDL | MFCD00009098 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. S16 - Keep away from sources of ignition. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | WT3511000 |
| HS Code | 29209085 |
| Hazard Class | 3.2 |
| Packing Group | III |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |